C15H24N2O — CID 104959145
1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-phenylpropan-2-amine (PubChem CID 104959145) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-phenylpropan-2-amine.
| Compound Name | 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-phenylpropan-2-amine |
|---|---|
| PubChem CID | 104959145 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-phenylpropan-2-amine |
| SMILES | C[C@@H]1CN(CC(N)Cc2ccccc2)C[C@H](C)O1 |
| InChI | InChI=1S/C15H24N2O/c1-12-9-17(10-13(2)18-12)11-15(16)8-14-6-4-3-5-7-14/h3-7,12-13,15H,8-11,16H2,1-2H3/t12-,13+,15? |
| InChIKey | PXBLSFFINGDCEG-NNQSOWQGSA-N |
| XLogP | 1.67 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |