C10H15N3O — CID 141138558
4-amino-N'-hydroxy-2-phenylbutanimidamide (PubChem CID 141138558) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-amino-N'-hydroxy-2-phenylbutanimidamide.
| Compound Name | 4-amino-N'-hydroxy-2-phenylbutanimidamide |
|---|---|
| PubChem CID | 141138558 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 4-amino-N'-hydroxy-2-phenylbutanimidamide |
| SMILES | NCCC(/C(N)=N/O)c1ccccc1 |
| InChI | InChI=1S/C10H15N3O/c11-7-6-9(10(12)13-14)8-4-2-1-3-5-8/h1-5,9,14H,6-7,11H2,(H2,12,13) |
| InChIKey | GDBGOJGHDFZOGQ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|