C16H28N4O — CID 77043954
3-[[1-(dimethylamino)-3-methylbutan-2-yl]amino]-N'-hydroxy-2-phenylpropanimidamide (PubChem CID 77043954) has the molecular formula C16H28N4O and a molecular weight of 292.43 g/mol. Its IUPAC name is 3-[[1-(dimethylamino)-3-methylbutan-2-yl]amino]-N'-hydroxy-2-phenylpropanimidamide.
| Compound Name | 3-[[1-(dimethylamino)-3-methylbutan-2-yl]amino]-N'-hydroxy-2-phenylpropanimidamide |
|---|---|
| PubChem CID | 77043954 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 3-[[1-(dimethylamino)-3-methylbutan-2-yl]amino]-N'-hydroxy-2-phenylpropanimidamide |
| SMILES | CC(C)C(CN(C)C)NCC(C(N)=NO)c1ccccc1 |
| InChI | InChI=1S/C16H28N4O/c1-12(2)15(11-20(3)4)18-10-14(16(17)19-21)13-8-6-5-7-9-13/h5-9,12,14-15,18,21H,10-11H2,1-4H3,(H2,17,19) |
| InChIKey | NLWZXNDMIFHSRP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|