C21H28N2O2 — CID 144818825
4-[2-[(3aR,6aS)-2-(cyclohexa-1,5-dien-1-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1-hydroxyethyl]phenol (PubChem CID 144818825) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 4-[2-[(3aR,6aS)-2-(cyclohexa-1,5-dien-1-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1-hydroxyethyl]phenol.
| Compound Name | 4-[2-[(3aR,6aS)-2-(cyclohexa-1,5-dien-1-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1-hydroxyethyl]phenol |
|---|---|
| PubChem CID | 144818825 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 4-[2-[(3aR,6aS)-2-(cyclohexa-1,5-dien-1-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1-hydroxyethyl]phenol |
| SMILES | Oc1ccc(C(O)CN2C[C@H]3CN(CC4=CCCC=C4)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C21H28N2O2/c24-20-8-6-17(7-9-20)21(25)15-23-13-18-11-22(12-19(18)14-23)10-16-4-2-1-3-5-16/h2,4-9,18-19,21,24-25H,1,3,10-15H2/t18-,19+,21? |
| InChIKey | CKVCUOYHHCVXJY-PMSBKCLSSA-N |
| XLogP | 2.57 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |