C20H25N3O2 — CID 138650278
4-[1-[(3aS,6aR)-5-pyrimidin-5-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]propan-2-yl]phenol (PubChem CID 138650278) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 4-[1-[(3aS,6aR)-5-pyrimidin-5-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]propan-2-yl]phenol.
| Compound Name | 4-[1-[(3aS,6aR)-5-pyrimidin-5-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]propan-2-yl]phenol |
|---|---|
| PubChem CID | 138650278 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 4-[1-[(3aS,6aR)-5-pyrimidin-5-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]propan-2-yl]phenol |
| SMILES | CC(CN1C[C@H]2CC(Oc3cncnc3)C[C@H]2C1)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H25N3O2/c1-14(15-2-4-18(24)5-3-15)10-23-11-16-6-19(7-17(16)12-23)25-20-8-21-13-22-9-20/h2-5,8-9,13-14,16-17,19,24H,6-7,10-12H2,1H3/t14?,16-,17+,19? |
| InChIKey | QHUCMSNRMDWFKT-WPUGQYJPSA-N |
| XLogP | 3.08 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |