C22H24FN3O2 — CID 134454569
4-[[(3aS,6aR)-2-[2-(6-fluoro-5-hydroxy-2-pyridinyl)propyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]benzonitrile (PubChem CID 134454569) has the molecular formula C22H24FN3O2 and a molecular weight of 381.45 g/mol. Its IUPAC name is 4-[[(3aS,6aR)-2-[2-(6-fluoro-5-hydroxy-2-pyridinyl)propyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]benzonitrile.
| Compound Name | 4-[[(3aS,6aR)-2-[2-(6-fluoro-5-hydroxy-2-pyridinyl)propyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]benzonitrile |
|---|---|
| PubChem CID | 134454569 |
| Molecular Formula | C22H24FN3O2 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 4-[[(3aS,6aR)-2-[2-(6-fluoro-5-hydroxy-2-pyridinyl)propyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]benzonitrile |
| SMILES | CC(CN1C[C@H]2CC(Oc3ccc(C#N)cc3)C[C@H]2C1)c1ccc(O)c(F)n1 |
| InChI | InChI=1S/C22H24FN3O2/c1-14(20-6-7-21(27)22(23)25-20)11-26-12-16-8-19(9-17(16)13-26)28-18-4-2-15(10-24)3-5-18/h2-7,14,16-17,19,27H,8-9,11-13H2,1H3/t14?,16-,17+,19? |
| InChIKey | XNVXBEJHNDPTNF-WPUGQYJPSA-N |
| XLogP | 3.69 |
| TPSA | 69.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|