C21H22FN3O2 — CID 121247598
4-[[(3aR,6aS)-2-[2-(6-fluoro-5-hydroxy-2-pyridinyl)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]benzonitrile (PubChem CID 121247598) has the molecular formula C21H22FN3O2 and a molecular weight of 367.42 g/mol. Its IUPAC name is 4-[[(3aR,6aS)-2-[2-(6-fluoro-5-hydroxy-2-pyridinyl)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]benzonitrile.
| Compound Name | 4-[[(3aR,6aS)-2-[2-(6-fluoro-5-hydroxy-2-pyridinyl)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]benzonitrile |
|---|---|
| PubChem CID | 121247598 |
| Molecular Formula | C21H22FN3O2 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 4-[[(3aR,6aS)-2-[2-(6-fluoro-5-hydroxy-2-pyridinyl)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]benzonitrile |
| SMILES | N#Cc1ccc(OC2C[C@@H]3CN(CCc4ccc(O)c(F)n4)C[C@@H]3C2)cc1 |
| InChI | InChI=1S/C21H22FN3O2/c22-21-20(26)6-3-17(24-21)7-8-25-12-15-9-19(10-16(15)13-25)27-18-4-1-14(11-23)2-5-18/h1-6,15-16,19,26H,7-10,12-13H2/t15-,16+,19? |
| InChIKey | HAYYPZDZXMBDPS-MCPYQZEQSA-N |
| XLogP | 3.13 |
| TPSA | 69.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|