C15H17N3O4 — CID 122022820
4-[[3-(4-cyanophenoxy)azetidine-1-carbonyl]amino]butanoic acid (PubChem CID 122022820) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 4-[[3-(4-cyanophenoxy)azetidine-1-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[3-(4-cyanophenoxy)azetidine-1-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122022820 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 4-[[3-(4-cyanophenoxy)azetidine-1-carbonyl]amino]butanoic acid |
| SMILES | N#Cc1ccc(OC2CN(C(=O)NCCCC(=O)O)C2)cc1 |
| InChI | InChI=1S/C15H17N3O4/c16-8-11-3-5-12(6-4-11)22-13-9-18(10-13)15(21)17-7-1-2-14(19)20/h3-6,13H,1-2,7,9-10H2,(H,17,21)(H,19,20) |
| InChIKey | ZFRRELSNGOQBLP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|