C20H28N4O2 — CID 22235678
N-butyl-8-[2-(4-cyanophenoxy)ethyl]-3,8-diazabicyclo[3.2.1]octane-3-carboxamide (PubChem CID 22235678) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-butyl-8-[2-(4-cyanophenoxy)ethyl]-3,8-diazabicyclo[3.2.1]octane-3-carboxamide.
| Compound Name | N-butyl-8-[2-(4-cyanophenoxy)ethyl]-3,8-diazabicyclo[3.2.1]octane-3-carboxamide |
|---|---|
| PubChem CID | 22235678 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | N-butyl-8-[2-(4-cyanophenoxy)ethyl]-3,8-diazabicyclo[3.2.1]octane-3-carboxamide |
| SMILES | CCCCNC(=O)N1CC2CCC(C1)N2CCOc1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H28N4O2/c1-2-3-10-22-20(25)23-14-17-6-7-18(15-23)24(17)11-12-26-19-8-4-16(13-21)5-9-19/h4-5,8-9,17-18H,2-3,6-7,10-12,14-15H2,1H3,(H,22,25) |
| InChIKey | PXDGCVVLVGBMTN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|