C26H25N5O4 — CID 22235585
8-[2-(4-cyanophenoxy)ethyl]-N-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3,8-diazabicyclo[3.2.1]octane-3-carboxamide (PubChem CID 22235585) has the molecular formula C26H25N5O4 and a molecular weight of 471.52 g/mol. Its IUPAC name is 8-[2-(4-cyanophenoxy)ethyl]-N-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3,8-diazabicyclo[3.2.1]octane-3-carboxamide.
| Compound Name | 8-[2-(4-cyanophenoxy)ethyl]-N-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3,8-diazabicyclo[3.2.1]octane-3-carboxamide |
|---|---|
| PubChem CID | 22235585 |
| Molecular Formula | C26H25N5O4 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 8-[2-(4-cyanophenoxy)ethyl]-N-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3,8-diazabicyclo[3.2.1]octane-3-carboxamide |
| SMILES | N#Cc1ccc(OCCN2C3CCC2CN(C(=O)Nc2ccc(N4C(=O)C=CC4=O)cc2)C3)cc1 |
| InChI | InChI=1S/C26H25N5O4/c27-15-18-1-9-23(10-2-18)35-14-13-30-21-7-8-22(30)17-29(16-21)26(34)28-19-3-5-20(6-4-19)31-24(32)11-12-25(31)33/h1-6,9-12,21-22H,7-8,13-14,16-17H2,(H,28,34) |
| InChIKey | WRVUQYFZIUVSCZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|