C20H29N5O — CID 22235648
8-[3-(4-cyanoanilino)propyl]-N-propan-2-yl-3,8-diazabicyclo[3.2.1]octane-3-carboxamide (PubChem CID 22235648) has the molecular formula C20H29N5O and a molecular weight of 355.49 g/mol. Its IUPAC name is 8-[3-(4-cyanoanilino)propyl]-N-propan-2-yl-3,8-diazabicyclo[3.2.1]octane-3-carboxamide.
| Compound Name | 8-[3-(4-cyanoanilino)propyl]-N-propan-2-yl-3,8-diazabicyclo[3.2.1]octane-3-carboxamide |
|---|---|
| PubChem CID | 22235648 |
| Molecular Formula | C20H29N5O |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 8-[3-(4-cyanoanilino)propyl]-N-propan-2-yl-3,8-diazabicyclo[3.2.1]octane-3-carboxamide |
| SMILES | CC(C)NC(=O)N1CC2CCC(C1)N2CCCNc1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H29N5O/c1-15(2)23-20(26)24-13-18-8-9-19(14-24)25(18)11-3-10-22-17-6-4-16(12-21)5-7-17/h4-7,15,18-19,22H,3,8-11,13-14H2,1-2H3,(H,23,26) |
| InChIKey | GJGSZNGWDBNTJP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 71.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|