C19H23N5S — CID 22235410
4-[3-[3-(1,3-thiazol-2-yl)-3,8-diazabicyclo[3.2.1]octan-8-yl]propylamino]benzonitrile (PubChem CID 22235410) has the molecular formula C19H23N5S and a molecular weight of 353.50 g/mol. Its IUPAC name is 4-[3-[3-(1,3-thiazol-2-yl)-3,8-diazabicyclo[3.2.1]octan-8-yl]propylamino]benzonitrile.
| Compound Name | 4-[3-[3-(1,3-thiazol-2-yl)-3,8-diazabicyclo[3.2.1]octan-8-yl]propylamino]benzonitrile |
|---|---|
| PubChem CID | 22235410 |
| Molecular Formula | C19H23N5S |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 4-[3-[3-(1,3-thiazol-2-yl)-3,8-diazabicyclo[3.2.1]octan-8-yl]propylamino]benzonitrile |
| SMILES | N#Cc1ccc(NCCCN2C3CCC2CN(c2nccs2)C3)cc1 |
| InChI | InChI=1S/C19H23N5S/c20-12-15-2-4-16(5-3-15)21-8-1-10-24-17-6-7-18(24)14-23(13-17)19-22-9-11-25-19/h2-5,9,11,17-18,21H,1,6-8,10,13-14H2 |
| InChIKey | UAYPJODINWJJSX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|