C24H36N4O — CID 18541050
4-[3-[8-[(3,3-dimethyl-2-oxobutyl)-methylamino]-3-azabicyclo[3.2.1]octan-3-yl]propylamino]benzonitrile (PubChem CID 18541050) has the molecular formula C24H36N4O and a molecular weight of 396.58 g/mol. Its IUPAC name is 4-[3-[8-[(3,3-dimethyl-2-oxobutyl)-methylamino]-3-azabicyclo[3.2.1]octan-3-yl]propylamino]benzonitrile.
| Compound Name | 4-[3-[8-[(3,3-dimethyl-2-oxobutyl)-methylamino]-3-azabicyclo[3.2.1]octan-3-yl]propylamino]benzonitrile |
|---|---|
| PubChem CID | 18541050 |
| Molecular Formula | C24H36N4O |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | 4-[3-[8-[(3,3-dimethyl-2-oxobutyl)-methylamino]-3-azabicyclo[3.2.1]octan-3-yl]propylamino]benzonitrile |
| SMILES | CN(CC(=O)C(C)(C)C)C1C2CCC1CN(CCCNc1ccc(C#N)cc1)C2 |
| InChI | InChI=1S/C24H36N4O/c1-24(2,3)22(29)17-27(4)23-19-8-9-20(23)16-28(15-19)13-5-12-26-21-10-6-18(14-25)7-11-21/h6-7,10-11,19-20,23,26H,5,8-9,12-13,15-17H2,1-4H3 |
| InChIKey | LCYJAPSJVDQCTR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|