C25H32N4 — CID 18541019
4-[3-[(3-benzyl-3-azabicyclo[3.2.1]octan-8-yl)-methylamino]propylamino]benzonitrile (PubChem CID 18541019) has the molecular formula C25H32N4 and a molecular weight of 388.56 g/mol. Its IUPAC name is 4-[3-[(3-benzyl-3-azabicyclo[3.2.1]octan-8-yl)-methylamino]propylamino]benzonitrile.
| Compound Name | 4-[3-[(3-benzyl-3-azabicyclo[3.2.1]octan-8-yl)-methylamino]propylamino]benzonitrile |
|---|---|
| PubChem CID | 18541019 |
| Molecular Formula | C25H32N4 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 4-[3-[(3-benzyl-3-azabicyclo[3.2.1]octan-8-yl)-methylamino]propylamino]benzonitrile |
| SMILES | CN(CCCNc1ccc(C#N)cc1)C1C2CCC1CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C25H32N4/c1-28(15-5-14-27-24-12-8-20(16-26)9-13-24)25-22-10-11-23(25)19-29(18-22)17-21-6-3-2-4-7-21/h2-4,6-9,12-13,22-23,25,27H,5,10-11,14-15,17-19H2,1H3 |
| InChIKey | GBYPDHXVPPOREZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 42.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|