C18H30ClN3 — CID 75511156
N'-(2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl)-N,N'-dimethylethane-1,2-diamine;hydrochloride (PubChem CID 75511156) has the molecular formula C18H30ClN3 and a molecular weight of 323.91 g/mol. Its IUPAC name is N'-(2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl)-N,N'-dimethylethane-1,2-diamine;hydrochloride.
| Compound Name | N'-(2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl)-N,N'-dimethylethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 75511156 |
| Molecular Formula | C18H30ClN3 |
| Molecular Weight | 323.91 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | N'-(2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl)-N,N'-dimethylethane-1,2-diamine;hydrochloride |
| SMILES | CNCCN(C)C1CCC2CN(Cc3ccccc3)CC21.Cl |
| InChI | InChI=1S/C18H29N3.ClH/c1-19-10-11-20(2)18-9-8-16-13-21(14-17(16)18)12-15-6-4-3-5-7-15;/h3-7,16-19H,8-14H2,1-2H3;1H |
| InChIKey | ZALBFQFXSINJQZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.91 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |