C25H31FN4O2S — CID 70151654
N-[3-[3-(4-cyanoanilino)propyl]-3-azabicyclo[3.2.1]octan-8-yl]-N-[(4-fluorophenyl)methyl]methanesulfonamide (PubChem CID 70151654) has the molecular formula C25H31FN4O2S and a molecular weight of 470.61 g/mol. Its IUPAC name is N-[3-[3-(4-cyanoanilino)propyl]-3-azabicyclo[3.2.1]octan-8-yl]-N-[(4-fluorophenyl)methyl]methanesulfonamide.
| Compound Name | N-[3-[3-(4-cyanoanilino)propyl]-3-azabicyclo[3.2.1]octan-8-yl]-N-[(4-fluorophenyl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 70151654 |
| Molecular Formula | C25H31FN4O2S |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | N-[3-[3-(4-cyanoanilino)propyl]-3-azabicyclo[3.2.1]octan-8-yl]-N-[(4-fluorophenyl)methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(Cc1ccc(F)cc1)C1C2CCC1CN(CCCNc1ccc(C#N)cc1)C2 |
| InChI | InChI=1S/C25H31FN4O2S/c1-33(31,32)30(16-20-3-9-23(26)10-4-20)25-21-7-8-22(25)18-29(17-21)14-2-13-28-24-11-5-19(15-27)6-12-24/h3-6,9-12,21-22,25,28H,2,7-8,13-14,16-18H2,1H3 |
| InChIKey | UVFXPGSNOMZPRV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|