C23H35N5O — CID 22235523
3-[3-(4-cyanoanilino)propyl]-N-hexyl-3,8-diazabicyclo[3.2.1]octane-8-carboxamide (PubChem CID 22235523) has the molecular formula C23H35N5O and a molecular weight of 397.57 g/mol. Its IUPAC name is 3-[3-(4-cyanoanilino)propyl]-N-hexyl-3,8-diazabicyclo[3.2.1]octane-8-carboxamide.
| Compound Name | 3-[3-(4-cyanoanilino)propyl]-N-hexyl-3,8-diazabicyclo[3.2.1]octane-8-carboxamide |
|---|---|
| PubChem CID | 22235523 |
| Molecular Formula | C23H35N5O |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | 3-[3-(4-cyanoanilino)propyl]-N-hexyl-3,8-diazabicyclo[3.2.1]octane-8-carboxamide |
| SMILES | CCCCCCNC(=O)N1C2CCC1CN(CCCNc1ccc(C#N)cc1)C2 |
| InChI | InChI=1S/C23H35N5O/c1-2-3-4-5-13-26-23(29)28-21-11-12-22(28)18-27(17-21)15-6-14-25-20-9-7-19(16-24)8-10-20/h7-10,21-22,25H,2-6,11-15,17-18H2,1H3,(H,26,29) |
| InChIKey | MJZJFPAZFJIOJM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 71.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|