C22H29N5O2 — CID 139987431
N-butyl-2-[8-[2-(2,4-dicyanophenoxy)ethyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]acetamide (PubChem CID 139987431) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is N-butyl-2-[8-[2-(2,4-dicyanophenoxy)ethyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]acetamide.
| Compound Name | N-butyl-2-[8-[2-(2,4-dicyanophenoxy)ethyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]acetamide |
|---|---|
| PubChem CID | 139987431 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | N-butyl-2-[8-[2-(2,4-dicyanophenoxy)ethyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]acetamide |
| SMILES | CCCCNC(=O)CN1CC2CCC(C1)N2CCOc1ccc(C#N)cc1C#N |
| InChI | InChI=1S/C22H29N5O2/c1-2-3-8-25-22(28)16-26-14-19-5-6-20(15-26)27(19)9-10-29-21-7-4-17(12-23)11-18(21)13-24/h4,7,11,19-20H,2-3,5-6,8-10,14-16H2,1H3,(H,25,28) |
| InChIKey | UEYTYEBAHBKQBV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 92.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|