C20H25N5O4 — CID 68925665
2-[7-[3-(2,4-dicyanophenoxy)propyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]ethylcarbamic acid (PubChem CID 68925665) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 2-[7-[3-(2,4-dicyanophenoxy)propyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]ethylcarbamic acid.
| Compound Name | 2-[7-[3-(2,4-dicyanophenoxy)propyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]ethylcarbamic acid |
|---|---|
| PubChem CID | 68925665 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 2-[7-[3-(2,4-dicyanophenoxy)propyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]ethylcarbamic acid |
| SMILES | N#Cc1ccc(OCCCN2CC3CN(CCNC(=O)O)CC(C2)O3)c(C#N)c1 |
| InChI | InChI=1S/C20H25N5O4/c21-9-15-2-3-19(16(8-15)10-22)28-7-1-5-24-11-17-13-25(6-4-23-20(26)27)14-18(12-24)29-17/h2-3,8,17-18,23H,1,4-7,11-14H2,(H,26,27) |
| InChIKey | ZRDZPQKTNTYEIU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 121.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|