C19H25FN4O4 — CID 68925723
2-[7-[3-(4-cyano-2-fluorophenoxy)propyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]ethylcarbamic acid (PubChem CID 68925723) has the molecular formula C19H25FN4O4 and a molecular weight of 392.43 g/mol. Its IUPAC name is 2-[7-[3-(4-cyano-2-fluorophenoxy)propyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]ethylcarbamic acid.
| Compound Name | 2-[7-[3-(4-cyano-2-fluorophenoxy)propyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]ethylcarbamic acid |
|---|---|
| PubChem CID | 68925723 |
| Molecular Formula | C19H25FN4O4 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 2-[7-[3-(4-cyano-2-fluorophenoxy)propyl]-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]ethylcarbamic acid |
| SMILES | N#Cc1ccc(OCCCN2CC3CN(CCNC(=O)O)CC(C2)O3)c(F)c1 |
| InChI | InChI=1S/C19H25FN4O4/c20-17-8-14(9-21)2-3-18(17)27-7-1-5-23-10-15-12-24(6-4-22-19(25)26)13-16(11-23)28-15/h2-3,8,15-16,22H,1,4-7,10-13H2,(H,25,26) |
| InChIKey | HBDQCEXWZHCPPK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|