C23H27FN4 — CID 22235360
4-[3-[3-[(4-fluorophenyl)methyl]-3,8-diazabicyclo[3.2.1]octan-8-yl]propylamino]benzonitrile (PubChem CID 22235360) has the molecular formula C23H27FN4 and a molecular weight of 378.50 g/mol. Its IUPAC name is 4-[3-[3-[(4-fluorophenyl)methyl]-3,8-diazabicyclo[3.2.1]octan-8-yl]propylamino]benzonitrile.
| Compound Name | 4-[3-[3-[(4-fluorophenyl)methyl]-3,8-diazabicyclo[3.2.1]octan-8-yl]propylamino]benzonitrile |
|---|---|
| PubChem CID | 22235360 |
| Molecular Formula | C23H27FN4 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 4-[3-[3-[(4-fluorophenyl)methyl]-3,8-diazabicyclo[3.2.1]octan-8-yl]propylamino]benzonitrile |
| SMILES | N#Cc1ccc(NCCCN2C3CCC2CN(Cc2ccc(F)cc2)C3)cc1 |
| InChI | InChI=1S/C23H27FN4/c24-20-6-2-19(3-7-20)15-27-16-22-10-11-23(17-27)28(22)13-1-12-26-21-8-4-18(14-25)5-9-21/h2-9,22-23,26H,1,10-13,15-17H2 |
| InChIKey | FJGCXAAOTIVNAD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 42.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|