C6H11Cl2N3S — CID 91623902
1-(1,3-thiazol-2-yl)azetidin-3-amine;dihydrochloride (PubChem CID 91623902) has the molecular formula C6H11Cl2N3S and a molecular weight of 228.15 g/mol. Its IUPAC name is 1-(1,3-thiazol-2-yl)azetidin-3-amine;dihydrochloride.
| Compound Name | 1-(1,3-thiazol-2-yl)azetidin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 91623902 |
| Molecular Formula | C6H11Cl2N3S |
| Molecular Weight | 228.15 g/mol |
| Exact Mass | 227.01 |
| IUPAC Name | 1-(1,3-thiazol-2-yl)azetidin-3-amine;dihydrochloride |
| SMILES | Cl.Cl.NC1CN(c2nccs2)C1 |
| InChI | InChI=1S/C6H9N3S.2ClH/c7-5-3-9(4-5)6-8-1-2-10-6;;/h1-2,5H,3-4,7H2;2*1H |
| InChIKey | BEKRXWMMXTXPJR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.15 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |