C11H15BrN2S — CID 130855848
2-(5-bromo-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-1,3-thiazole (PubChem CID 130855848) has the molecular formula C11H15BrN2S and a molecular weight of 287.23 g/mol. Its IUPAC name is 2-(5-bromo-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-1,3-thiazole.
| Compound Name | 2-(5-bromo-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 130855848 |
| Molecular Formula | C11H15BrN2S |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 2-(5-bromo-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-1,3-thiazole |
| SMILES | BrC1CCC2CN(c3nccs3)CC2C1 |
| InChI | InChI=1S/C11H15BrN2S/c12-10-2-1-8-6-14(7-9(8)5-10)11-13-3-4-15-11/h3-4,8-10H,1-2,5-7H2 |
| InChIKey | CKOQIGFUYSZYDH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|