C9H12N2O2S — CID 30072707
(3R)-1-(1,3-thiazol-2-yl)piperidine-3-carboxylic acid (PubChem CID 30072707) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is (3R)-1-(1,3-thiazol-2-yl)piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-(1,3-thiazol-2-yl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 30072707 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | (3R)-1-(1,3-thiazol-2-yl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN(c2nccs2)C1 |
| InChI | InChI=1S/C9H12N2O2S/c12-8(13)7-2-1-4-11(6-7)9-10-3-5-14-9/h3,5,7H,1-2,4,6H2,(H,12,13)/t7-/m1/s1 |
| InChIKey | HBUSXPMRNOKFBL-SSDOTTSWSA-N |
| XLogP | 1.44 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |