C10H14N2O2S — CID 30078408
(3R)-1-(4-methyl-1,3-thiazol-2-yl)piperidine-3-carboxylic acid (PubChem CID 30078408) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is (3R)-1-(4-methyl-1,3-thiazol-2-yl)piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-(4-methyl-1,3-thiazol-2-yl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 30078408 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (3R)-1-(4-methyl-1,3-thiazol-2-yl)piperidine-3-carboxylic acid |
| SMILES | Cc1csc(N2CCC[C@@H](C(=O)O)C2)n1 |
| InChI | InChI=1S/C10H14N2O2S/c1-7-6-15-10(11-7)12-4-2-3-8(5-12)9(13)14/h6,8H,2-5H2,1H3,(H,13,14)/t8-/m1/s1 |
| InChIKey | PPQOXDSSWJFEEK-MRVPVSSYSA-N |
| XLogP | 1.75 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |