C16H21N5OS — CID 95739298
(3R)-N-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-1-(1,3-thiazol-2-yl)piperidine-3-carboxamide (PubChem CID 95739298) has the molecular formula C16H21N5OS and a molecular weight of 331.44 g/mol. Its IUPAC name is (3R)-N-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-1-(1,3-thiazol-2-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-1-(1,3-thiazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95739298 |
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | (3R)-N-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-1-(1,3-thiazol-2-yl)piperidine-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCc2nccn2C1)[C@@H]1CCCN(c2nccs2)C1 |
| InChI | InChI=1S/C16H21N5OS/c22-15(19-13-3-4-14-17-5-8-20(14)11-13)12-2-1-7-21(10-12)16-18-6-9-23-16/h5-6,8-9,12-13H,1-4,7,10-11H2,(H,19,22)/t12-,13-/m1/s1 |
| InChIKey | RLOPEMBERRVDPE-CHWSQXEVSA-N |
| XLogP | 1.69 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |