C17H26N4OS — CID 138045032
(3aR,7aS)-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide (PubChem CID 138045032) has the molecular formula C17H26N4OS and a molecular weight of 334.49 g/mol. Its IUPAC name is (3aR,7aS)-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide.
| Compound Name | (3aR,7aS)-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 138045032 |
| Molecular Formula | C17H26N4OS |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (3aR,7aS)-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide |
| SMILES | O=C(NC1CCN(c2nccs2)CC1)N1C[C@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C17H26N4OS/c22-16(21-11-13-3-1-2-4-14(13)12-21)19-15-5-8-20(9-6-15)17-18-7-10-23-17/h7,10,13-15H,1-6,8-9,11-12H2,(H,19,22)/t13-,14+ |
| InChIKey | CKXLLDASGIFAAJ-OKILXGFUSA-N |
| XLogP | 2.94 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |