C17H28N4OS — CID 30138516
(2S)-N-cycloheptyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propanamide (PubChem CID 30138516) has the molecular formula C17H28N4OS and a molecular weight of 336.51 g/mol. Its IUPAC name is (2S)-N-cycloheptyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propanamide.
| Compound Name | (2S)-N-cycloheptyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 30138516 |
| Molecular Formula | C17H28N4OS |
| Molecular Weight | 336.51 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (2S)-N-cycloheptyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)NC1CCCCCC1)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C17H28N4OS/c1-14(16(22)19-15-6-4-2-3-5-7-15)20-9-11-21(12-10-20)17-18-8-13-23-17/h8,13-15H,2-7,9-12H2,1H3,(H,19,22)/t14-/m0/s1 |
| InChIKey | BFFOZJIMFLWZAC-AWEZNQCLSA-N |
| XLogP | 2.49 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |