C16H21N5O3S2 — CID 55499702
N-(4-sulfamoylphenyl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propanamide (PubChem CID 55499702) has the molecular formula C16H21N5O3S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is N-(4-sulfamoylphenyl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propanamide.
| Compound Name | N-(4-sulfamoylphenyl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 55499702 |
| Molecular Formula | C16H21N5O3S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N-(4-sulfamoylphenyl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propanamide |
| SMILES | CC(C(=O)Nc1ccc(S(N)(=O)=O)cc1)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C16H21N5O3S2/c1-12(20-7-9-21(10-8-20)16-18-6-11-25-16)15(22)19-13-2-4-14(5-3-13)26(17,23)24/h2-6,11-12H,7-10H2,1H3,(H,19,22)(H2,17,23,24) |
| InChIKey | SNHBXNZHJLNBBU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |