C26H30N4O3S — CID 42996416
2-(4-benzhydrylpiperazin-1-yl)-N-(4-sulfamoylphenyl)propanamide (PubChem CID 42996416) has the molecular formula C26H30N4O3S and a molecular weight of 478.62 g/mol. Its IUPAC name is 2-(4-benzhydrylpiperazin-1-yl)-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 2-(4-benzhydrylpiperazin-1-yl)-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 42996416 |
| Molecular Formula | C26H30N4O3S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 2-(4-benzhydrylpiperazin-1-yl)-N-(4-sulfamoylphenyl)propanamide |
| SMILES | CC(C(=O)Nc1ccc(S(N)(=O)=O)cc1)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H30N4O3S/c1-20(26(31)28-23-12-14-24(15-13-23)34(27,32)33)29-16-18-30(19-17-29)25(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-15,20,25H,16-19H2,1H3,(H,28,31)(H2,27,32,33) |
| InChIKey | ATCPGROCTRPDCZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |