C15H24N4O5S2 — CID 41331851
(2S)-2-[4-(methanesulfonamido)piperidin-1-yl]-N-(4-sulfamoylphenyl)propanamide (PubChem CID 41331851) has the molecular formula C15H24N4O5S2 and a molecular weight of 404.51 g/mol. Its IUPAC name is (2S)-2-[4-(methanesulfonamido)piperidin-1-yl]-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | (2S)-2-[4-(methanesulfonamido)piperidin-1-yl]-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 41331851 |
| Molecular Formula | C15H24N4O5S2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | (2S)-2-[4-(methanesulfonamido)piperidin-1-yl]-N-(4-sulfamoylphenyl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(S(N)(=O)=O)cc1)N1CCC(NS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C15H24N4O5S2/c1-11(19-9-7-13(8-10-19)18-25(2,21)22)15(20)17-12-3-5-14(6-4-12)26(16,23)24/h3-6,11,13,18H,7-10H2,1-2H3,(H,17,20)(H2,16,23,24)/t11-/m0/s1 |
| InChIKey | CUTUMZAYTFZXOY-NSHDSACASA-N |
| XLogP | -0.33 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |