C15H25ClN4O3S — CID 119918352
2-[3-(methylamino)piperidin-1-yl]-N-(4-sulfamoylphenyl)propanamide;hydrochloride (PubChem CID 119918352) has the molecular formula C15H25ClN4O3S and a molecular weight of 376.91 g/mol. Its IUPAC name is 2-[3-(methylamino)piperidin-1-yl]-N-(4-sulfamoylphenyl)propanamide;hydrochloride.
| Compound Name | 2-[3-(methylamino)piperidin-1-yl]-N-(4-sulfamoylphenyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119918352 |
| Molecular Formula | C15H25ClN4O3S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 2-[3-(methylamino)piperidin-1-yl]-N-(4-sulfamoylphenyl)propanamide;hydrochloride |
| SMILES | CNC1CCCN(C(C)C(=O)Nc2ccc(S(N)(=O)=O)cc2)C1.Cl |
| InChI | InChI=1S/C15H24N4O3S.ClH/c1-11(19-9-3-4-13(10-19)17-2)15(20)18-12-5-7-14(8-6-12)23(16,21)22;/h5-8,11,13,17H,3-4,9-10H2,1-2H3,(H,18,20)(H2,16,21,22);1H |
| InChIKey | BNJBSEBAYCSZGB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |