C15H23Cl2N3O — CID 119918800
N-(3-chlorophenyl)-2-[3-(methylamino)piperidin-1-yl]propanamide;hydrochloride (PubChem CID 119918800) has the molecular formula C15H23Cl2N3O and a molecular weight of 332.28 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[3-(methylamino)piperidin-1-yl]propanamide;hydrochloride.
| Compound Name | N-(3-chlorophenyl)-2-[3-(methylamino)piperidin-1-yl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119918800 |
| Molecular Formula | C15H23Cl2N3O |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-(3-chlorophenyl)-2-[3-(methylamino)piperidin-1-yl]propanamide;hydrochloride |
| SMILES | CNC1CCCN(C(C)C(=O)Nc2cccc(Cl)c2)C1.Cl |
| InChI | InChI=1S/C15H22ClN3O.ClH/c1-11(19-8-4-7-14(10-19)17-2)15(20)18-13-6-3-5-12(16)9-13;/h3,5-6,9,11,14,17H,4,7-8,10H2,1-2H3,(H,18,20);1H |
| InChIKey | NLNXNRGLFMUELR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |