C15H17ClN4OS — CID 90597446
1-(4-chlorophenyl)-3-[1-(1,3-thiazol-2-yl)piperidin-4-yl]urea (PubChem CID 90597446) has the molecular formula C15H17ClN4OS and a molecular weight of 336.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[1-(1,3-thiazol-2-yl)piperidin-4-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[1-(1,3-thiazol-2-yl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 90597446 |
| Molecular Formula | C15H17ClN4OS |
| Molecular Weight | 336.85 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[1-(1,3-thiazol-2-yl)piperidin-4-yl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)NC1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C15H17ClN4OS/c16-11-1-3-12(4-2-11)18-14(21)19-13-5-8-20(9-6-13)15-17-7-10-22-15/h1-4,7,10,13H,5-6,8-9H2,(H2,18,19,21) |
| InChIKey | SXKSMCCWEMFHAI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.85 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |