C15H16ClFN4OS — CID 134359721
1-(3-chloro-4-fluorophenyl)-3-[1-(1,3-thiazol-2-yl)piperidin-3-yl]urea (PubChem CID 134359721) has the molecular formula C15H16ClFN4OS and a molecular weight of 354.84 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[1-(1,3-thiazol-2-yl)piperidin-3-yl]urea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[1-(1,3-thiazol-2-yl)piperidin-3-yl]urea |
|---|---|
| PubChem CID | 134359721 |
| Molecular Formula | C15H16ClFN4OS |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[1-(1,3-thiazol-2-yl)piperidin-3-yl]urea |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)NC1CCCN(c2nccs2)C1 |
| InChI | InChI=1S/C15H16ClFN4OS/c16-12-8-10(3-4-13(12)17)19-14(22)20-11-2-1-6-21(9-11)15-18-5-7-23-15/h3-5,7-8,11H,1-2,6,9H2,(H2,19,20,22) |
| InChIKey | CUCDCJDUGYEUFW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |