C20H22Cl2N4O2 — CID 11026212
1-(4-chlorophenyl)-3-[3-[(4-chlorophenyl)carbamoylamino]cyclohexyl]urea (PubChem CID 11026212) has the molecular formula C20H22Cl2N4O2 and a molecular weight of 421.33 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[3-[(4-chlorophenyl)carbamoylamino]cyclohexyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[3-[(4-chlorophenyl)carbamoylamino]cyclohexyl]urea |
|---|---|
| PubChem CID | 11026212 |
| Molecular Formula | C20H22Cl2N4O2 |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[3-[(4-chlorophenyl)carbamoylamino]cyclohexyl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)NC1CCCC(NC(=O)Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C20H22Cl2N4O2/c21-13-4-8-15(9-5-13)23-19(27)25-17-2-1-3-18(12-17)26-20(28)24-16-10-6-14(22)7-11-16/h4-11,17-18H,1-3,12H2,(H2,23,25,27)(H2,24,26,28) |
| InChIKey | XBWNJGQLNCAOLX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |