C10H15ClN2S — CID 106838472
2-[4-(1-chloroethyl)piperidin-1-yl]-1,3-thiazole (PubChem CID 106838472) has the molecular formula C10H15ClN2S and a molecular weight of 230.76 g/mol. Its IUPAC name is 2-[4-(1-chloroethyl)piperidin-1-yl]-1,3-thiazole.
| Compound Name | 2-[4-(1-chloroethyl)piperidin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 106838472 |
| Molecular Formula | C10H15ClN2S |
| Molecular Weight | 230.76 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2-[4-(1-chloroethyl)piperidin-1-yl]-1,3-thiazole |
| SMILES | CC(Cl)C1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C10H15ClN2S/c1-8(11)9-2-5-13(6-3-9)10-12-4-7-14-10/h4,7-9H,2-3,5-6H2,1H3 |
| InChIKey | HAWIMTMSUBLSAM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.76 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|