C15H19N3S — CID 43599525
(3aR,7aS)-2-thieno[3,2-c]pyridin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine (PubChem CID 43599525) has the molecular formula C15H19N3S and a molecular weight of 273.40 g/mol. Its IUPAC name is (3aR,7aS)-2-thieno[3,2-c]pyridin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine.
| Compound Name | (3aR,7aS)-2-thieno[3,2-c]pyridin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
|---|---|
| PubChem CID | 43599525 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | (3aR,7aS)-2-thieno[3,2-c]pyridin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
| SMILES | NC1CC[C@@H]2CN(c3nccc4sccc34)C[C@@H]2C1 |
| InChI | InChI=1S/C15H19N3S/c16-12-2-1-10-8-18(9-11(10)7-12)15-13-4-6-19-14(13)3-5-17-15/h3-6,10-12H,1-2,7-9,16H2/t10-,11+,12?/m1/s1 |
| InChIKey | MTRXBVAGUJPCQF-UBNQGINQSA-N |
| XLogP | 2.86 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |