C11H12N2O2S — CID 106673226
1-thieno[3,2-c]pyridin-4-ylpyrrolidine-3,4-diol (PubChem CID 106673226) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 1-thieno[3,2-c]pyridin-4-ylpyrrolidine-3,4-diol.
| Compound Name | 1-thieno[3,2-c]pyridin-4-ylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106673226 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 1-thieno[3,2-c]pyridin-4-ylpyrrolidine-3,4-diol |
| SMILES | OC1CN(c2nccc3sccc23)CC1O |
| InChI | InChI=1S/C11H12N2O2S/c14-8-5-13(6-9(8)15)11-7-2-4-16-10(7)1-3-12-11/h1-4,8-9,14-15H,5-6H2 |
| InChIKey | RYTGJCTXYJDEDL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |