C12H15N3OS — CID 61338182
(4-thieno[3,2-c]pyridin-4-ylmorpholin-2-yl)methanamine (PubChem CID 61338182) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is (4-thieno[3,2-c]pyridin-4-ylmorpholin-2-yl)methanamine.
| Compound Name | (4-thieno[3,2-c]pyridin-4-ylmorpholin-2-yl)methanamine |
|---|---|
| PubChem CID | 61338182 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | (4-thieno[3,2-c]pyridin-4-ylmorpholin-2-yl)methanamine |
| SMILES | NCC1CN(c2nccc3sccc23)CCO1 |
| InChI | InChI=1S/C12H15N3OS/c13-7-9-8-15(4-5-16-9)12-10-2-6-17-11(10)1-3-14-12/h1-3,6,9H,4-5,7-8,13H2 |
| InChIKey | FZYUPUPGPZPKQK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |