About (4-thieno[3,2-c]pyridin-4-ylmorpholin-2-yl)methanamine
(4-thieno[3,2-c]pyridin-4-ylmorpholin-2-yl)methanamine (PubChem CID 61338182) has the molecular formula C12H15N3OS
and a molecular weight of 249.34 g/mol. Its IUPAC name is (4-thieno[3,2-c]pyridin-4-ylmorpholin-2-yl)methanamine.
Molecular Properties
| Compound Name | (4-thieno[3,2-c]pyridin-4-ylmorpholin-2-yl)methanamine |
| PubChem CID | 61338182 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | (4-thieno[3,2-c]pyridin-4-ylmorpholin-2-yl)methanamine |
| SMILES | NCC1CN(c2nccc3sccc23)CCO1 |
| InChI | InChI=1S/C12H15N3OS/c13-7-9-8-15(4-5-16-9)12-10-2-6-17-11(10)1-3-14-12/h1-3,6,9H,4-5,7-8,13H2 |
| InChIKey | FZYUPUPGPZPKQK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-thieno[3,2-c]pyridin-4-ylmorpholin-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-thieno[3,2-c]pyridin-4-ylmorpholin-2-yl)methanamine?
The IUPAC name of (4-thieno[3,2-c]pyridin-4-ylmorpholin-2-yl)methanamine (CID 61338182) is (4-thieno[3,2-c]pyridin-4-ylmorpholin-2-yl)methanamine.
What is the SMILES notation for (4-thieno[3,2-c]pyridin-4-ylmorpholin-2-yl)methanamine?
The canonical SMILES for (4-thieno[3,2-c]pyridin-4-ylmorpholin-2-yl)methanamine is NCC1CN(c2nccc3sccc23)CCO1.
What is the InChIKey of (4-thieno[3,2-c]pyridin-4-ylmorpholin-2-yl)methanamine?
The InChIKey is FZYUPUPGPZPKQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3OS/c13-7-9-8-15(4-5-16-9)12-10-2-6-17-11(10)1-3-14-12/h1-3,6,9H,4-5,7-8,13H2.
What are the key properties of (4-thieno[3,2-c]pyridin-4-ylmorpholin-2-yl)methanamine?
(4-thieno[3,2-c]pyridin-4-ylmorpholin-2-yl)methanamine has a molecular weight of 249.34 g/mol, XLogP of 1.46, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-thieno[3,2-c]pyridin-4-ylmorpholin-2-yl)methanamine is sourced from PubChem (CID 61338182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).