About (1-thieno[3,2-c]pyridin-4-ylpyrrolidin-2-yl)methanamine
(1-thieno[3,2-c]pyridin-4-ylpyrrolidin-2-yl)methanamine (PubChem CID 62592284) has the molecular formula C12H15N3S
and a molecular weight of 233.34 g/mol. Its IUPAC name is (1-thieno[3,2-c]pyridin-4-ylpyrrolidin-2-yl)methanamine.
Molecular Properties
| Compound Name | (1-thieno[3,2-c]pyridin-4-ylpyrrolidin-2-yl)methanamine |
| PubChem CID | 62592284 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | (1-thieno[3,2-c]pyridin-4-ylpyrrolidin-2-yl)methanamine |
| SMILES | NCC1CCCN1c1nccc2sccc12 |
| InChI | InChI=1S/C12H15N3S/c13-8-9-2-1-6-15(9)12-10-4-7-16-11(10)3-5-14-12/h3-5,7,9H,1-2,6,8,13H2 |
| InChIKey | XHSVTVGKLWDCGT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-thieno[3,2-c]pyridin-4-ylpyrrolidin-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-thieno[3,2-c]pyridin-4-ylpyrrolidin-2-yl)methanamine?
The IUPAC name of (1-thieno[3,2-c]pyridin-4-ylpyrrolidin-2-yl)methanamine (CID 62592284) is (1-thieno[3,2-c]pyridin-4-ylpyrrolidin-2-yl)methanamine.
What is the SMILES notation for (1-thieno[3,2-c]pyridin-4-ylpyrrolidin-2-yl)methanamine?
The canonical SMILES for (1-thieno[3,2-c]pyridin-4-ylpyrrolidin-2-yl)methanamine is NCC1CCCN1c1nccc2sccc12.
What is the InChIKey of (1-thieno[3,2-c]pyridin-4-ylpyrrolidin-2-yl)methanamine?
The InChIKey is XHSVTVGKLWDCGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3S/c13-8-9-2-1-6-15(9)12-10-4-7-16-11(10)3-5-14-12/h3-5,7,9H,1-2,6,8,13H2.
What are the key properties of (1-thieno[3,2-c]pyridin-4-ylpyrrolidin-2-yl)methanamine?
(1-thieno[3,2-c]pyridin-4-ylpyrrolidin-2-yl)methanamine has a molecular weight of 233.34 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-thieno[3,2-c]pyridin-4-ylpyrrolidin-2-yl)methanamine is sourced from PubChem (CID 62592284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).