C8H13N3S — CID 18446041
[1-(1,3-thiazol-2-yl)pyrrolidin-2-yl]methanamine (PubChem CID 18446041) has the molecular formula C8H13N3S and a molecular weight of 183.28 g/mol. Its IUPAC name is [1-(1,3-thiazol-2-yl)pyrrolidin-2-yl]methanamine.
| Compound Name | [1-(1,3-thiazol-2-yl)pyrrolidin-2-yl]methanamine |
|---|---|
| PubChem CID | 18446041 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | [1-(1,3-thiazol-2-yl)pyrrolidin-2-yl]methanamine |
| SMILES | NCC1CCCN1c1nccs1 |
| InChI | InChI=1S/C8H13N3S/c9-6-7-2-1-4-11(7)8-10-3-5-12-8/h3,5,7H,1-2,4,6,9H2 |
| InChIKey | DIWJYCFZJBYRAR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |