C8H12N4O2S — CID 102771476
[1-(5-nitro-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanamine (PubChem CID 102771476) has the molecular formula C8H12N4O2S and a molecular weight of 228.28 g/mol. Its IUPAC name is [1-(5-nitro-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanamine.
| Compound Name | [1-(5-nitro-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanamine |
|---|---|
| PubChem CID | 102771476 |
| Molecular Formula | C8H12N4O2S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | [1-(5-nitro-1,3-thiazol-2-yl)pyrrolidin-2-yl]methanamine |
| SMILES | NCC1CCCN1c1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C8H12N4O2S/c9-4-6-2-1-3-11(6)8-10-5-7(15-8)12(13)14/h5-6H,1-4,9H2 |
| InChIKey | OYQMEPTVYFJVEY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|