C12H21N3S — CID 96591866
[(2R,3R)-2-ethyl-1-(1,3-thiazol-2-yl)azepan-3-yl]methanamine (PubChem CID 96591866) has the molecular formula C12H21N3S and a molecular weight of 239.39 g/mol. Its IUPAC name is [(2R,3R)-2-ethyl-1-(1,3-thiazol-2-yl)azepan-3-yl]methanamine.
| Compound Name | [(2R,3R)-2-ethyl-1-(1,3-thiazol-2-yl)azepan-3-yl]methanamine |
|---|---|
| PubChem CID | 96591866 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | [(2R,3R)-2-ethyl-1-(1,3-thiazol-2-yl)azepan-3-yl]methanamine |
| SMILES | CC[C@@H]1[C@@H](CN)CCCCN1c1nccs1 |
| InChI | InChI=1S/C12H21N3S/c1-2-11-10(9-13)5-3-4-7-15(11)12-14-6-8-16-12/h6,8,10-11H,2-5,7,9,13H2,1H3/t10-,11-/m1/s1 |
| InChIKey | RDKRZEIQOYUYAA-GHMZBOCLSA-N |
| XLogP | 2.49 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |