About [4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)morpholin-2-yl]methanamine
[4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)morpholin-2-yl]methanamine (PubChem CID 59829603) has the molecular formula C11H13ClN4OS
and a molecular weight of 284.77 g/mol. Its IUPAC name is [4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)morpholin-2-yl]methanamine.
Molecular Properties
| Compound Name | [4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)morpholin-2-yl]methanamine |
| PubChem CID | 59829603 |
| Molecular Formula | C11H13ClN4OS |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | [4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)morpholin-2-yl]methanamine |
| SMILES | NCC1CN(c2nc(Cl)nc3ccsc23)CCO1 |
| InChI | InChI=1S/C11H13ClN4OS/c12-11-14-8-1-4-18-9(8)10(15-11)16-2-3-17-7(5-13)6-16/h1,4,7H,2-3,5-6,13H2 |
| InChIKey | BTOTYOGZTOAMCR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)morpholin-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)morpholin-2-yl]methanamine?
The IUPAC name of [4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)morpholin-2-yl]methanamine (CID 59829603) is [4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)morpholin-2-yl]methanamine.
What is the SMILES notation for [4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)morpholin-2-yl]methanamine?
The canonical SMILES for [4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)morpholin-2-yl]methanamine is NCC1CN(c2nc(Cl)nc3ccsc23)CCO1.
What is the InChIKey of [4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)morpholin-2-yl]methanamine?
The InChIKey is BTOTYOGZTOAMCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN4OS/c12-11-14-8-1-4-18-9(8)10(15-11)16-2-3-17-7(5-13)6-16/h1,4,7H,2-3,5-6,13H2.
What are the key properties of [4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)morpholin-2-yl]methanamine?
[4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)morpholin-2-yl]methanamine has a molecular weight of 284.77 g/mol, XLogP of 1.51, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)morpholin-2-yl]methanamine is sourced from PubChem (CID 59829603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).