C13H15BrN2S — CID 102961165
4-(3-bromo-4-methylpiperidin-1-yl)thieno[3,2-c]pyridine (PubChem CID 102961165) has the molecular formula C13H15BrN2S and a molecular weight of 311.25 g/mol. Its IUPAC name is 4-(3-bromo-4-methylpiperidin-1-yl)thieno[3,2-c]pyridine.
| Compound Name | 4-(3-bromo-4-methylpiperidin-1-yl)thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 102961165 |
| Molecular Formula | C13H15BrN2S |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 4-(3-bromo-4-methylpiperidin-1-yl)thieno[3,2-c]pyridine |
| SMILES | CC1CCN(c2nccc3sccc23)CC1Br |
| InChI | InChI=1S/C13H15BrN2S/c1-9-3-6-16(8-11(9)14)13-10-4-7-17-12(10)2-5-15-13/h2,4-5,7,9,11H,3,6,8H2,1H3 |
| InChIKey | MKMBLEIGMQGJNA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|