C12H11N5S — CID 165435561
4-[3-(triazol-2-yl)azetidin-1-yl]thieno[3,2-c]pyridine (PubChem CID 165435561) has the molecular formula C12H11N5S and a molecular weight of 257.32 g/mol. Its IUPAC name is 4-[3-(triazol-2-yl)azetidin-1-yl]thieno[3,2-c]pyridine.
| Compound Name | 4-[3-(triazol-2-yl)azetidin-1-yl]thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 165435561 |
| Molecular Formula | C12H11N5S |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 4-[3-(triazol-2-yl)azetidin-1-yl]thieno[3,2-c]pyridine |
| SMILES | c1cc2sccc2c(N2CC(n3nccn3)C2)n1 |
| InChI | InChI=1S/C12H11N5S/c1-3-13-12(10-2-6-18-11(1)10)16-7-9(8-16)17-14-4-5-15-17/h1-6,9H,7-8H2 |
| InChIKey | YTZHHBLAYOVBCX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |