C16H20N4 — CID 61142833
(3aR,7aS)-2-quinazolin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine (PubChem CID 61142833) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is (3aR,7aS)-2-quinazolin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine.
| Compound Name | (3aR,7aS)-2-quinazolin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
|---|---|
| PubChem CID | 61142833 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (3aR,7aS)-2-quinazolin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
| SMILES | NC1CC[C@@H]2CN(c3ncnc4ccccc34)C[C@@H]2C1 |
| InChI | InChI=1S/C16H20N4/c17-13-6-5-11-8-20(9-12(11)7-13)16-14-3-1-2-4-15(14)18-10-19-16/h1-4,10-13H,5-9,17H2/t11-,12+,13?/m1/s1 |
| InChIKey | HQHMASCNQBUWMT-OJRHAOMCSA-N |
| XLogP | 2.19 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |