C13H22N4S — CID 62808150
4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]cyclohexan-1-amine (PubChem CID 62808150) has the molecular formula C13H22N4S and a molecular weight of 266.41 g/mol. Its IUPAC name is 4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]cyclohexan-1-amine.
| Compound Name | 4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 62808150 |
| Molecular Formula | C13H22N4S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]cyclohexan-1-amine |
| SMILES | NC1CCC(N2CCN(c3nccs3)CC2)CC1 |
| InChI | InChI=1S/C13H22N4S/c14-11-1-3-12(4-2-11)16-6-8-17(9-7-16)13-15-5-10-18-13/h5,10-12H,1-4,6-9,14H2 |
| InChIKey | XGQUOUQPPXKEBU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |