About 1-thieno[3,2-d]pyrimidin-4-ylazetidin-3-amine;dihydrochloride
1-thieno[3,2-d]pyrimidin-4-ylazetidin-3-amine;dihydrochloride (PubChem CID 146077996) has the molecular formula C9H12Cl2N4S
and a molecular weight of 279.20 g/mol. Its IUPAC name is 1-thieno[3,2-d]pyrimidin-4-ylazetidin-3-amine;dihydrochloride.
Molecular Properties
| Compound Name | 1-thieno[3,2-d]pyrimidin-4-ylazetidin-3-amine;dihydrochloride |
| PubChem CID | 146077996 |
| Molecular Formula | C9H12Cl2N4S |
| Molecular Weight | 279.20 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 1-thieno[3,2-d]pyrimidin-4-ylazetidin-3-amine;dihydrochloride |
| SMILES | Cl.Cl.NC1CN(c2ncnc3ccsc23)C1 |
| InChI | InChI=1S/C9H10N4S.2ClH/c10-6-3-13(4-6)9-8-7(1-2-14-8)11-5-12-9;;/h1-2,5-6H,3-4,10H2;2*1H |
| InChIKey | ASOPPPKPIGWMPT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.20 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-thieno[3,2-d]pyrimidin-4-ylazetidin-3-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-thieno[3,2-d]pyrimidin-4-ylazetidin-3-amine;dihydrochloride?
The IUPAC name of 1-thieno[3,2-d]pyrimidin-4-ylazetidin-3-amine;dihydrochloride (CID 146077996) is 1-thieno[3,2-d]pyrimidin-4-ylazetidin-3-amine;dihydrochloride.
What is the SMILES notation for 1-thieno[3,2-d]pyrimidin-4-ylazetidin-3-amine;dihydrochloride?
The canonical SMILES for 1-thieno[3,2-d]pyrimidin-4-ylazetidin-3-amine;dihydrochloride is Cl.Cl.NC1CN(c2ncnc3ccsc23)C1.
What is the InChIKey of 1-thieno[3,2-d]pyrimidin-4-ylazetidin-3-amine;dihydrochloride?
The InChIKey is ASOPPPKPIGWMPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4S.2ClH/c10-6-3-13(4-6)9-8-7(1-2-14-8)11-5-12-9;;/h1-2,5-6H,3-4,10H2;2*1H.
What are the key properties of 1-thieno[3,2-d]pyrimidin-4-ylazetidin-3-amine;dihydrochloride?
1-thieno[3,2-d]pyrimidin-4-ylazetidin-3-amine;dihydrochloride has a molecular weight of 279.20 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-thieno[3,2-d]pyrimidin-4-ylazetidin-3-amine;dihydrochloride is sourced from PubChem (CID 146077996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).